C18H30N2O4S — CID 3870084
tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-(2-thiophen-2-ylethylcarbamoylamino)propanoate (PubChem CID 3870084) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-(2-thiophen-2-ylethylcarbamoylamino)propanoate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-(2-thiophen-2-ylethylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 3870084 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-(2-thiophen-2-ylethylcarbamoylamino)propanoate |
| SMILES | CC(C)(C)OCC(NC(=O)NCCc1cccs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O4S/c1-17(2,3)23-12-14(15(21)24-18(4,5)6)20-16(22)19-10-9-13-8-7-11-25-13/h7-8,11,14H,9-10,12H2,1-6H3,(H2,19,20,22) |
| InChIKey | MRBWXCKJOZQILL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |