C24H23N3O3S2 — CID 3873404
N-[2-(3-piperidin-1-ylsulfonylphenyl)-3H-isoindol-1-ylidene]thiophene-2-carboxamide (PubChem CID 3873404) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[2-(3-piperidin-1-ylsulfonylphenyl)-3H-isoindol-1-ylidene]thiophene-2-carboxamide.
| Compound Name | N-[2-(3-piperidin-1-ylsulfonylphenyl)-3H-isoindol-1-ylidene]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3873404 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[2-(3-piperidin-1-ylsulfonylphenyl)-3H-isoindol-1-ylidene]thiophene-2-carboxamide |
| SMILES | O=C(/N=C1\c2ccccc2CN1c1cccc(S(=O)(=O)N2CCCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C24H23N3O3S2/c28-24(22-12-7-15-31-22)25-23-21-11-3-2-8-18(21)17-27(23)19-9-6-10-20(16-19)32(29,30)26-13-4-1-5-14-26/h2-3,6-12,15-16H,1,4-5,13-14,17H2/b25-23+ |
| InChIKey | FDAZGZLAQAOGKC-WJTDDFOZSA-N |
| XLogP | 4.53 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|