C28H27N3O6 — CID 3875662
2-[2-[(2-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]ethyl 2-[(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 3875662) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is 2-[2-[(2-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]ethyl 2-[(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | 2-[2-[(2-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]ethyl 2-[(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 3875662 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[2-[(2-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]ethyl 2-[(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | COc1ccc(C=NOCC(=O)OCCn2c(COc3ccccc3C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H27N3O6/c1-20-7-3-6-10-25(20)36-18-26-30-24-9-5-4-8-23(24)28(33)31(26)15-16-35-27(32)19-37-29-17-21-11-13-22(34-2)14-12-21/h3-14,17H,15-16,18-19H2,1-2H3 |
| InChIKey | SACUUCFBNXXVCI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|