C29H29N3O6 — CID 3424673
2-[2-[(3,4-dimethoxyphenyl)methyl]-4-oxoquinazolin-3-yl]ethyl 2-(1-phenylethylideneamino)oxyacetate (PubChem CID 3424673) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]-4-oxoquinazolin-3-yl]ethyl 2-(1-phenylethylideneamino)oxyacetate.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]-4-oxoquinazolin-3-yl]ethyl 2-(1-phenylethylideneamino)oxyacetate |
|---|---|
| PubChem CID | 3424673 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]-4-oxoquinazolin-3-yl]ethyl 2-(1-phenylethylideneamino)oxyacetate |
| SMILES | COc1ccc(Cc2nc3ccccc3c(=O)n2CCOC(=O)CON=C(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H29N3O6/c1-20(22-9-5-4-6-10-22)31-38-19-28(33)37-16-15-32-27(30-24-12-8-7-11-23(24)29(32)34)18-21-13-14-25(35-2)26(17-21)36-3/h4-14,17H,15-16,18-19H2,1-3H3 |
| InChIKey | BNWVGIKGBQFVGT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|