C18H24N4O3 — CID 38766462
3-(2,3-dimethylphenoxy)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]propanehydrazide (PubChem CID 38766462) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]propanehydrazide.
| Compound Name | 3-(2,3-dimethylphenoxy)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 38766462 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]propanehydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)CCOc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C18H24N4O3/c1-12-6-5-7-16(15(12)4)25-9-8-17(23)19-20-18(24)11-22-14(3)10-13(2)21-22/h5-7,10H,8-9,11H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | DZIUUQIORMGSJG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|