C15H18N4O3S — CID 4792264
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide (PubChem CID 4792264) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide |
|---|---|
| PubChem CID | 4792264 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)CCC(=O)c2cccs2)n1 |
| InChI | InChI=1S/C15H18N4O3S/c1-10-8-11(2)19(18-10)9-15(22)17-16-14(21)6-5-12(20)13-4-3-7-23-13/h3-4,7-8H,5-6,9H2,1-2H3,(H,16,21)(H,17,22) |
| InChIKey | HMAJYPFFUZAFSB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|