C13H24N4O3S — CID 38884
Bupirimate (PubChem CID 38884) has the molecular formula C13H24N4O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate.
| Compound Name | Bupirimate |
|---|---|
| PubChem CID | 38884 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate |
| SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| InChI | InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) |
| InChIKey | DSKJPMWIHSOYEA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | 397 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |