C15H13N5OS — CID 38897994
(E)-N-(4-methyl-1,3-thiazol-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enamide (PubChem CID 38897994) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is (E)-N-(4-methyl-1,3-thiazol-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-methyl-1,3-thiazol-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 38897994 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (E)-N-(4-methyl-1,3-thiazol-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enamide |
| SMILES | Cc1csc(NC(=O)/C=C/c2cnn(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C15H13N5OS/c1-11-10-22-15(17-11)18-14(21)8-7-12-9-16-20(19-12)13-5-3-2-4-6-13/h2-10H,1H3,(H,17,18,21)/b8-7+ |
| InChIKey | DAHNBILONIEBEW-BQYQJAHWSA-N |
| XLogP | 2.68 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|