C24H26N2O7S — CID 3890629
ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoyloxy]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3890629) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoyloxy]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoyloxy]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3890629 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoyloxy]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)OC(=O)C=Cc2ccc([N+](=O)[O-])cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H26N2O7S/c1-3-18(33-20(27)14-11-15-9-12-16(13-10-15)26(30)31)22(28)25-23-21(24(29)32-4-2)17-7-5-6-8-19(17)34-23/h9-14,18H,3-8H2,1-2H3,(H,25,28) |
| InChIKey | AVRCPIMJGDXWRP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|