C23H21BrN2O4 — CID 38909487
[2-[(3-bromophenyl)methoxy]phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 38909487) has the molecular formula C23H21BrN2O4 and a molecular weight of 469.34 g/mol. Its IUPAC name is [2-[(3-bromophenyl)methoxy]phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [2-[(3-bromophenyl)methoxy]phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38909487 |
| Molecular Formula | C23H21BrN2O4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [2-[(3-bromophenyl)methoxy]phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2ccccc2OCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C23H21BrN2O4/c24-18-6-3-5-17(15-18)16-30-20-8-2-1-7-19(20)22(27)25-10-12-26(13-11-25)23(28)21-9-4-14-29-21/h1-9,14-15H,10-13,16H2 |
| InChIKey | RMFGXERHGUUSOZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |