C12H9ClN4O4 — CID 3894659
3-chloro-7-(3-nitrophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (PubChem CID 3894659) has the molecular formula C12H9ClN4O4 and a molecular weight of 308.68 g/mol. Its IUPAC name is 3-chloro-7-(3-nitrophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
| Compound Name | 3-chloro-7-(3-nitrophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
|---|---|
| PubChem CID | 3894659 |
| Molecular Formula | C12H9ClN4O4 |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-chloro-7-(3-nitrophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| SMILES | O=C1CC2(CC(Cl)N=N2)C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9ClN4O4/c13-9-5-12(15-14-9)6-10(18)16(11(12)19)7-2-1-3-8(4-7)17(20)21/h1-4,9H,5-6H2 |
| InChIKey | FEBLIVBHGPYGTP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|