C13H11Cl2N3O2 — CID 7256225
(3S,5S)-3-chloro-7-(3-chloro-4-methylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (PubChem CID 7256225) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is (3S,5S)-3-chloro-7-(3-chloro-4-methylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
| Compound Name | (3S,5S)-3-chloro-7-(3-chloro-4-methylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
|---|---|
| PubChem CID | 7256225 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (3S,5S)-3-chloro-7-(3-chloro-4-methylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@]3(C[C@H](Cl)N=N3)C2=O)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O2/c1-7-2-3-8(4-9(7)14)18-11(19)6-13(12(18)20)5-10(15)16-17-13/h2-4,10H,5-6H2,1H3/t10-,13-/m1/s1 |
| InChIKey | DBQMSXSRTPPKHJ-ZWNOBZJWSA-N |
| XLogP | 3.07 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|