C13H11Cl2N3O3 — CID 5102912
3-chloro-7-(3-chloro-4-methoxyphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (PubChem CID 5102912) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-chloro-7-(3-chloro-4-methoxyphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
| Compound Name | 3-chloro-7-(3-chloro-4-methoxyphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
|---|---|
| PubChem CID | 5102912 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-chloro-7-(3-chloro-4-methoxyphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| SMILES | COc1ccc(N2C(=O)CC3(CC(Cl)N=N3)C2=O)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-21-9-3-2-7(4-8(9)14)18-11(19)6-13(12(18)20)5-10(15)16-17-13/h2-4,10H,5-6H2,1H3 |
| InChIKey | MKTYXXQUYZURSU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|