C11H15N3O5 — CID 38990239
4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneazaniumyl]butanoate (PubChem CID 38990239) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneazaniumyl]butanoate.
| Compound Name | 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneazaniumyl]butanoate |
|---|---|
| PubChem CID | 38990239 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneazaniumyl]butanoate |
| SMILES | CN1C(=O)C(/C=[NH+]/CCCC(=O)[O-])C(=O)N(C)C1=O |
| InChI | InChI=1S/C11H15N3O5/c1-13-9(17)7(10(18)14(2)11(13)19)6-12-5-3-4-8(15)16/h6-7H,3-5H2,1-2H3,(H,15,16)/b12-6+ |
| InChIKey | BANONKNPFDKKOU-WUXMJOGZSA-N |
| XLogP | -3.67 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|