C19H18N4O4S — CID 38996983
2-(1,3-dioxoisoindol-2-yl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)ethanesulfonamide (PubChem CID 38996983) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 38996983 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)NCCc1ncc2ccccn12 |
| InChI | InChI=1S/C19H18N4O4S/c24-18-15-6-1-2-7-16(15)19(25)23(18)11-12-28(26,27)21-9-8-17-20-13-14-5-3-4-10-22(14)17/h1-7,10,13,21H,8-9,11-12H2 |
| InChIKey | KRUCUNCTCSJJTG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|