C14H13ClN4O2S — CID 110309581
6-chloro-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)pyridine-3-sulfonamide (PubChem CID 110309581) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 6-chloro-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110309581 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 6-chloro-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1ncc2ccccn12)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H13ClN4O2S/c15-13-5-4-12(10-16-13)22(20,21)18-7-6-14-17-9-11-3-1-2-8-19(11)14/h1-5,8-10,18H,6-7H2 |
| InChIKey | HNKDKHWDWVWTJR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|