C30H30N2O4 — CID 3901259
4-acetamido-1-hydroxy-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide (PubChem CID 3901259) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-acetamido-1-hydroxy-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide.
| Compound Name | 4-acetamido-1-hydroxy-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3901259 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 4-acetamido-1-hydroxy-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)c3cc(NC(C)=O)c4ccccc4c3O)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O4/c1-5-30(3,4)20-10-14-22(15-11-20)36-23-16-12-21(13-17-23)32-29(35)26-18-27(31-19(2)33)24-8-6-7-9-25(24)28(26)34/h6-18,34H,5H2,1-4H3,(H,31,33)(H,32,35) |
| InChIKey | VNIDLUSQNLHLHD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|