C28H26INO3 — CID 3949960
1-hydroxy-4-iodo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide (PubChem CID 3949960) has the molecular formula C28H26INO3 and a molecular weight of 551.42 g/mol. Its IUPAC name is 1-hydroxy-4-iodo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-4-iodo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3949960 |
| Molecular Formula | C28H26INO3 |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 1-hydroxy-4-iodo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]naphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)c3cc(I)c4ccccc4c3O)cc2)cc1 |
| InChI | InChI=1S/C28H26INO3/c1-4-28(2,3)18-9-13-20(14-10-18)33-21-15-11-19(12-16-21)30-27(32)24-17-25(29)22-7-5-6-8-23(22)26(24)31/h5-17,31H,4H2,1-3H3,(H,30,32) |
| InChIKey | SUTRXPHYKZXUGH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|