C14H18N2O4S — CID 39026767
1-(3,4-diethoxyphenyl)sulfonyl-3-methylpyrazole (PubChem CID 39026767) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)sulfonyl-3-methylpyrazole.
| Compound Name | 1-(3,4-diethoxyphenyl)sulfonyl-3-methylpyrazole |
|---|---|
| PubChem CID | 39026767 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)sulfonyl-3-methylpyrazole |
| SMILES | CCOc1ccc(S(=O)(=O)n2ccc(C)n2)cc1OCC |
| InChI | InChI=1S/C14H18N2O4S/c1-4-19-13-7-6-12(10-14(13)20-5-2)21(17,18)16-9-8-11(3)15-16/h6-10H,4-5H2,1-3H3 |
| InChIKey | YALBXSFDTZKHAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |