C27H26ClFN4O5S — CID 3902938
N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 3902938) has the molecular formula C27H26ClFN4O5S and a molecular weight of 573.05 g/mol. Its IUPAC name is N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 3902938 |
| Molecular Formula | C27H26ClFN4O5S |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(NC(=O)CN2C(=O)NC(CC)(c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H26ClFN4O5S/c1-3-27(18-10-12-19(29)13-11-18)25(35)32(26(36)31-27)17-24(34)30-23-16-21(14-15-22(23)28)39(37,38)33(4-2)20-8-6-5-7-9-20/h5-16H,3-4,17H2,1-2H3,(H,30,34)(H,31,36) |
| InChIKey | GLIXCYVBOQPUGP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|