C22H17ClF4N2O4S — CID 4840754
N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 4840754) has the molecular formula C22H17ClF4N2O4S and a molecular weight of 516.90 g/mol. Its IUPAC name is N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 4840754 |
| Molecular Formula | C22H17ClF4N2O4S |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | N-[2-chloro-5-[ethyl(phenyl)sulfamoyl]phenyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(NC(=O)COc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C22H17ClF4N2O4S/c1-2-29(13-6-4-3-5-7-13)34(31,32)14-8-9-15(23)18(10-14)28-19(30)12-33-22-20(26)16(24)11-17(25)21(22)27/h3-11H,2,12H2,1H3,(H,28,30) |
| InChIKey | JTQQNCSWNRVQIA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|