C10H7N5 — CID 39045153
5-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 39045153) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is 5-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyrimidine.
| Compound Name | 5-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyrimidine |
|---|---|
| PubChem CID | 39045153 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | c1ccc(-c2ccnc3nncn23)nc1 |
| InChI | InChI=1S/C10H7N5/c1-2-5-11-8(3-1)9-4-6-12-10-14-13-7-15(9)10/h1-7H |
| InChIKey | RILHHERIOOIQTH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |