C19H27N3O3 — CID 39061133
2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 39061133) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 39061133 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(NC(=O)CN2CC(=O)Oc3ccccc32)CC(C)(C)N1 |
| InChI | InChI=1S/C19H27N3O3/c1-18(2)9-13(10-19(3,4)21-18)20-16(23)11-22-12-17(24)25-15-8-6-5-7-14(15)22/h5-8,13,21H,9-12H2,1-4H3,(H,20,23) |
| InChIKey | IZCSRQOUGFBWEM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|