C14H16N2O5S — CID 6592322
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 6592322) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 6592322 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccccc21)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O5S/c17-13(15-10-5-6-22(19,20)9-10)7-16-8-14(18)21-12-4-2-1-3-11(12)16/h1-4,10H,5-9H2,(H,15,17)/t10-/m0/s1 |
| InChIKey | CVJHVRYYDUAWJR-JTQLQIEISA-N |
| XLogP | -0.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|