C19H17ClN2O3 — CID 39069027
6-chloro-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3H-1,4-benzoxazin-2-one (PubChem CID 39069027) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 6-chloro-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3H-1,4-benzoxazin-2-one.
| Compound Name | 6-chloro-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 39069027 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 6-chloro-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3H-1,4-benzoxazin-2-one |
| SMILES | O=C1CN(CC(=O)N2CCc3ccccc3C2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C19H17ClN2O3/c20-15-5-6-17-16(9-15)22(12-19(24)25-17)11-18(23)21-8-7-13-3-1-2-4-14(13)10-21/h1-6,9H,7-8,10-12H2 |
| InChIKey | OVDGHVFNOSTIEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|