C21H19BrN2O3S2 — CID 39153809
3-[(4-bromophenyl)sulfonylamino]-N-cyclopropyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 39153809) has the molecular formula C21H19BrN2O3S2 and a molecular weight of 491.43 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-cyclopropyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-cyclopropyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 39153809 |
| Molecular Formula | C21H19BrN2O3S2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-cyclopropyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(NS(=O)(=O)c2ccc(Br)cc2)c1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C21H19BrN2O3S2/c22-16-6-10-20(11-7-16)29(26,27)23-17-4-1-3-15(13-17)21(25)24(18-8-9-18)14-19-5-2-12-28-19/h1-7,10-13,18,23H,8-9,14H2 |
| InChIKey | AMIPYVCLFJPBIU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |