C18H21N3O2S — CID 39161677
N-[4,5-dimethyl-3-(piperazine-1-carbonyl)thiophen-2-yl]benzamide (PubChem CID 39161677) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-(piperazine-1-carbonyl)thiophen-2-yl]benzamide.
| Compound Name | N-[4,5-dimethyl-3-(piperazine-1-carbonyl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 39161677 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[4,5-dimethyl-3-(piperazine-1-carbonyl)thiophen-2-yl]benzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2)c(C(=O)N2CCNCC2)c1C |
| InChI | InChI=1S/C18H21N3O2S/c1-12-13(2)24-17(20-16(22)14-6-4-3-5-7-14)15(12)18(23)21-10-8-19-9-11-21/h3-7,19H,8-11H2,1-2H3,(H,20,22) |
| InChIKey | AINPFWGXXYZSSV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |