C20H22N2S — CID 39163872
4-[[5-ethyl-4-(4-ethylphenyl)-1,3-thiazol-2-yl]methyl]aniline (PubChem CID 39163872) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-[[5-ethyl-4-(4-ethylphenyl)-1,3-thiazol-2-yl]methyl]aniline.
| Compound Name | 4-[[5-ethyl-4-(4-ethylphenyl)-1,3-thiazol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 39163872 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[[5-ethyl-4-(4-ethylphenyl)-1,3-thiazol-2-yl]methyl]aniline |
| SMILES | CCc1ccc(-c2nc(Cc3ccc(N)cc3)sc2CC)cc1 |
| InChI | InChI=1S/C20H22N2S/c1-3-14-5-9-16(10-6-14)20-18(4-2)23-19(22-20)13-15-7-11-17(21)12-8-15/h5-12H,3-4,13,21H2,1-2H3 |
| InChIKey | YOGBIHJOQOANCU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|