C11H11BrN2S — CID 82134771
5-bromo-4-(4-ethylphenyl)-1,3-thiazol-2-amine (PubChem CID 82134771) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 5-bromo-4-(4-ethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-4-(4-ethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82134771 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-bromo-4-(4-ethylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCc1ccc(-c2nc(N)sc2Br)cc1 |
| InChI | InChI=1S/C11H11BrN2S/c1-2-7-3-5-8(6-4-7)9-10(12)15-11(13)14-9/h3-6H,2H2,1H3,(H2,13,14) |
| InChIKey | USJLAIAAOBVDPD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |