C12H10Br2S — CID 44632438
2,3-dibromo-5-(4-ethylphenyl)thiophene (PubChem CID 44632438) has the molecular formula C12H10Br2S and a molecular weight of 346.09 g/mol. Its IUPAC name is 2,3-dibromo-5-(4-ethylphenyl)thiophene.
| Compound Name | 2,3-dibromo-5-(4-ethylphenyl)thiophene |
|---|---|
| PubChem CID | 44632438 |
| Molecular Formula | C12H10Br2S |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 343.89 |
| IUPAC Name | 2,3-dibromo-5-(4-ethylphenyl)thiophene |
| SMILES | CCc1ccc(-c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C12H10Br2S/c1-2-8-3-5-9(6-4-8)11-7-10(13)12(14)15-11/h3-7H,2H2,1H3 |
| InChIKey | HWBHFYYASIBWAZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |