C28H26N4O6 — CID 3920678
3,4-dimethoxy-N-[2-oxo-2-[2-[4-(quinolin-8-yloxymethyl)benzoyl]hydrazinyl]ethyl]benzamide (PubChem CID 3920678) has the molecular formula C28H26N4O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-[2-[4-(quinolin-8-yloxymethyl)benzoyl]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-[2-[4-(quinolin-8-yloxymethyl)benzoyl]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 3920678 |
| Molecular Formula | C28H26N4O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-[2-[4-(quinolin-8-yloxymethyl)benzoyl]hydrazinyl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NNC(=O)c2ccc(COc3cccc4cccnc34)cc2)cc1OC |
| InChI | InChI=1S/C28H26N4O6/c1-36-22-13-12-21(15-24(22)37-2)27(34)30-16-25(33)31-32-28(35)20-10-8-18(9-11-20)17-38-23-7-3-5-19-6-4-14-29-26(19)23/h3-15H,16-17H2,1-2H3,(H,30,34)(H,31,33)(H,32,35) |
| InChIKey | LHBPDGABANYWFR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|