C16H17N3O3 — CID 39219698
3-(2,3,4-trimethoxyphenyl)-1H-indazol-4-amine (PubChem CID 39219698) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-(2,3,4-trimethoxyphenyl)-1H-indazol-4-amine.
| Compound Name | 3-(2,3,4-trimethoxyphenyl)-1H-indazol-4-amine |
|---|---|
| PubChem CID | 39219698 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(2,3,4-trimethoxyphenyl)-1H-indazol-4-amine |
| SMILES | COc1ccc(-c2n[nH]c3cccc(N)c23)c(OC)c1OC |
| InChI | InChI=1S/C16H17N3O3/c1-20-12-8-7-9(15(21-2)16(12)22-3)14-13-10(17)5-4-6-11(13)18-19-14/h4-8H,17H2,1-3H3,(H,18,19) |
| InChIKey | DCLPSJHWBXWKHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|