C13H10F3NO4 — CID 39234576
2-[4-methoxy-6-(trifluoromethoxy)quinolin-2-yl]acetic acid (PubChem CID 39234576) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-[4-methoxy-6-(trifluoromethoxy)quinolin-2-yl]acetic acid.
| Compound Name | 2-[4-methoxy-6-(trifluoromethoxy)quinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 39234576 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[4-methoxy-6-(trifluoromethoxy)quinolin-2-yl]acetic acid |
| SMILES | COc1cc(CC(=O)O)nc2ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C13H10F3NO4/c1-20-11-4-7(5-12(18)19)17-10-3-2-8(6-9(10)11)21-13(14,15)16/h2-4,6H,5H2,1H3,(H,18,19) |
| InChIKey | HIRHAQDJFNQRNJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |