C18H16N4O2S — CID 39330963
3-cyano-N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 39330963) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39330963 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-cyano-N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)n(-c2ccccc2NS(=O)(=O)c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C18H16N4O2S/c1-13-10-14(2)22(20-13)18-9-4-3-8-17(18)21-25(23,24)16-7-5-6-15(11-16)12-19/h3-11,21H,1-2H3 |
| InChIKey | URJSAMMCGVQLTQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |