C22H21Cl2N3O4 — CID 39335122
1-(2,5-dichlorophenyl)-N-(3-hydroxypropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide (PubChem CID 39335122) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-N-(3-hydroxypropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)-N-(3-hydroxypropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 39335122 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-N-(3-hydroxypropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)-c1c(c(C(=O)NCCCO)nn1-c1cc(Cl)ccc1Cl)C2 |
| InChI | InChI=1S/C22H21Cl2N3O4/c1-30-18-9-12-8-15-20(22(29)25-6-3-7-28)26-27(17-10-13(23)4-5-16(17)24)21(15)14(12)11-19(18)31-2/h4-5,9-11,28H,3,6-8H2,1-2H3,(H,25,29) |
| InChIKey | IANHLZKRVATCJT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|