C17H15N5O2S — CID 39341757
4-cyano-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]benzenesulfonamide (PubChem CID 39341757) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 4-cyano-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39341757 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-cyano-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]benzenesulfonamide |
| SMILES | CCn1cnnc1-c1cccc(NS(=O)(=O)c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C17H15N5O2S/c1-2-22-12-19-20-17(22)14-4-3-5-15(10-14)21-25(23,24)16-8-6-13(11-18)7-9-16/h3-10,12,21H,2H2,1H3 |
| InChIKey | HDQIHLPBIQOFBY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |