C21H27FN2O3S — CID 39482944
N-ethyl-N-(2-ethylbutyl)-4-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 39482944) has the molecular formula C21H27FN2O3S and a molecular weight of 406.52 g/mol. Its IUPAC name is N-ethyl-N-(2-ethylbutyl)-4-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-ethyl-N-(2-ethylbutyl)-4-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 39482944 |
| Molecular Formula | C21H27FN2O3S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-ethyl-N-(2-ethylbutyl)-4-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CCC(CC)CN(CC)C(=O)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H27FN2O3S/c1-4-16(5-2)15-24(6-3)21(25)17-11-13-18(14-12-17)28(26,27)23-20-10-8-7-9-19(20)22/h7-14,16,23H,4-6,15H2,1-3H3 |
| InChIKey | NHZZGULUBKIOIO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |