C18H24NO2+ — CID 3956257
6,7-dimethoxy-2-prop-2-ynylspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] (PubChem CID 3956257) has the molecular formula C18H24NO2+ and a molecular weight of 286.39 g/mol. Its IUPAC name is 6,7-dimethoxy-2-prop-2-ynylspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane].
| Compound Name | 6,7-dimethoxy-2-prop-2-ynylspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] |
|---|---|
| PubChem CID | 3956257 |
| Molecular Formula | C18H24NO2+ |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 6,7-dimethoxy-2-prop-2-ynylspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] |
| SMILES | C#CC[NH+]1Cc2cc(OC)c(OC)cc2C2(CCCC2)C1 |
| InChI | InChI=1S/C18H23NO2/c1-4-9-19-12-14-10-16(20-2)17(21-3)11-15(14)18(13-19)7-5-6-8-18/h1,10-11H,5-9,12-13H2,2-3H3/p+1 |
| InChIKey | MTACYFVKBBSVOS-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|