C24H36N2O4S — CID 3956730
[4-[[1-adamantylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 3956730) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is [4-[[1-adamantylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[1-adamantylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3956730 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [4-[[1-adamantylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(CC(C)C)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H36N2O4S/c1-4-31(28,29)30-22-7-5-18(6-8-22)16-26(15-17(2)3)23(27)25-24-12-19-9-20(13-24)11-21(10-19)14-24/h5-8,17,19-21H,4,9-16H2,1-3H3,(H,25,27) |
| InChIKey | HSOQQZNXVQMLGX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|