C17H23ClN6O2 — CID 3960724
2-[5-[1-(dimethylamino)cyclopentyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate (PubChem CID 3960724) has the molecular formula C17H23ClN6O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[5-[1-(dimethylamino)cyclopentyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate.
| Compound Name | 2-[5-[1-(dimethylamino)cyclopentyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 3960724 |
| Molecular Formula | C17H23ClN6O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[5-[1-(dimethylamino)cyclopentyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate |
| SMILES | CN(C)C1(c2nnnn2CCOC(=O)Nc2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C17H23ClN6O2/c1-23(2)17(9-3-4-10-17)15-20-21-22-24(15)11-12-26-16(25)19-14-7-5-13(18)6-8-14/h5-8H,3-4,9-12H2,1-2H3,(H,19,25) |
| InChIKey | LCUHMWXOIVJZGT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |