C22H25ClN6O4S — CID 3569813
2-[5-[1-(benzenesulfonamido)cyclohexyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate (PubChem CID 3569813) has the molecular formula C22H25ClN6O4S and a molecular weight of 505.00 g/mol. Its IUPAC name is 2-[5-[1-(benzenesulfonamido)cyclohexyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate.
| Compound Name | 2-[5-[1-(benzenesulfonamido)cyclohexyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 3569813 |
| Molecular Formula | C22H25ClN6O4S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 2-[5-[1-(benzenesulfonamido)cyclohexyl]tetrazol-1-yl]ethyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCCn1nnnc1C1(NS(=O)(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H25ClN6O4S/c23-17-9-11-18(12-10-17)24-21(30)33-16-15-29-20(25-27-28-29)22(13-5-2-6-14-22)26-34(31,32)19-7-3-1-4-8-19/h1,3-4,7-12,26H,2,5-6,13-16H2,(H,24,30) |
| InChIKey | FJTLKVALQROWAO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |