C18H13BrN4O2 — CID 3961258
3-(4-bromo-3-nitrophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 3961258) has the molecular formula C18H13BrN4O2 and a molecular weight of 397.23 g/mol. Its IUPAC name is 3-(4-bromo-3-nitrophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-bromo-3-nitrophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3961258 |
| Molecular Formula | C18H13BrN4O2 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 3-(4-bromo-3-nitrophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc2nc(C(C#N)=Cc3ccc(Br)c([N+](=O)[O-])c3)[nH]c2cc1C |
| InChI | InChI=1S/C18H13BrN4O2/c1-10-5-15-16(6-11(10)2)22-18(21-15)13(9-20)7-12-3-4-14(19)17(8-12)23(24)25/h3-8H,1-2H3,(H,21,22) |
| InChIKey | XAUZVKFLNUPCLM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|