C14H20ClNO2S2 — CID 39657222
4-chloro-N-(2-cyclopentylsulfanylethyl)-2-methylbenzenesulfonamide (PubChem CID 39657222) has the molecular formula C14H20ClNO2S2 and a molecular weight of 333.91 g/mol. Its IUPAC name is 4-chloro-N-(2-cyclopentylsulfanylethyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-cyclopentylsulfanylethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39657222 |
| Molecular Formula | C14H20ClNO2S2 |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-chloro-N-(2-cyclopentylsulfanylethyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCCSC1CCCC1 |
| InChI | InChI=1S/C14H20ClNO2S2/c1-11-10-12(15)6-7-14(11)20(17,18)16-8-9-19-13-4-2-3-5-13/h6-7,10,13,16H,2-5,8-9H2,1H3 |
| InChIKey | PNIZAXVLXCEUDO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|