C13H17Cl2NO2S2 — CID 34270274
2,6-dichloro-N-(2-cyclopentylsulfanylethyl)benzenesulfonamide (PubChem CID 34270274) has the molecular formula C13H17Cl2NO2S2 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-cyclopentylsulfanylethyl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(2-cyclopentylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 34270274 |
| Molecular Formula | C13H17Cl2NO2S2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2,6-dichloro-N-(2-cyclopentylsulfanylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCSC1CCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S2/c14-11-6-3-7-12(15)13(11)20(17,18)16-8-9-19-10-4-1-2-5-10/h3,6-7,10,16H,1-2,4-5,8-9H2 |
| InChIKey | XYPYYLJNUDXGPD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|