C20H21ClN2O4S — CID 39730897
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 39730897) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 39730897 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1ccc2c(c1)C(=O)N(CCCOC)C2=O |
| InChI | InChI=1S/C20H21ClN2O4S/c1-3-22(12-14-6-8-17(21)28-14)18(24)13-5-7-15-16(11-13)20(26)23(19(15)25)9-4-10-27-2/h5-8,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | XOAAPOOYFQKFQQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|