C22H32N2O6S2 — CID 39774866
ethyl 4-[[(3S,4R)-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-yl]amino]piperidine-1-carboxylate (PubChem CID 39774866) has the molecular formula C22H32N2O6S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is ethyl 4-[[(3S,4R)-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(3S,4R)-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39774866 |
| Molecular Formula | C22H32N2O6S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | ethyl 4-[[(3S,4R)-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N[C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C22H32N2O6S2/c1-2-30-22(25)24-11-9-18(10-12-24)23-20-14-31(26,27)15-21(20)32(28,29)19-8-7-16-5-3-4-6-17(16)13-19/h7-8,13,18,20-21,23H,2-6,9-12,14-15H2,1H3/t20-,21-/m0/s1 |
| InChIKey | OAIPMQUPLPPEJC-SFTDATJTSA-N |
| XLogP | 1.72 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |