C18H26N2O6S2 — CID 39775180
4-[(3S,4R)-1,1-dioxo-4-(4-propan-2-yloxyphenyl)sulfonylthiolan-3-yl]piperazine-1-carbaldehyde (PubChem CID 39775180) has the molecular formula C18H26N2O6S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[(3S,4R)-1,1-dioxo-4-(4-propan-2-yloxyphenyl)sulfonylthiolan-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[(3S,4R)-1,1-dioxo-4-(4-propan-2-yloxyphenyl)sulfonylthiolan-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 39775180 |
| Molecular Formula | C18H26N2O6S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[(3S,4R)-1,1-dioxo-4-(4-propan-2-yloxyphenyl)sulfonylthiolan-3-yl]piperazine-1-carbaldehyde |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)[C@H]2CS(=O)(=O)C[C@@H]2N2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O6S2/c1-14(2)26-15-3-5-16(6-4-15)28(24,25)18-12-27(22,23)11-17(18)20-9-7-19(13-21)8-10-20/h3-6,13-14,17-18H,7-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | PRGYILDNVFIKDU-ROUUACIJSA-N |
| XLogP | 0.19 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|