C21H18N2O6S — CID 3982716
3-[5-[(2,4-dimethoxy-3-methylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3982716) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-[5-[(2,4-dimethoxy-3-methylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[(2,4-dimethoxy-3-methylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3982716 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-[5-[(2,4-dimethoxy-3-methylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | COc1ccc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)c(OC)c1C |
| InChI | InChI=1S/C21H18N2O6S/c1-11-16(28-2)8-7-12(17(11)29-3)10-15-18(24)22-21(30)23(19(15)25)14-6-4-5-13(9-14)20(26)27/h4-10H,1-3H3,(H,26,27)(H,22,24,30) |
| InChIKey | QJHNWLOYGBPXRP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|