C19H13N3O4S3 — CID 39836218
N-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide (PubChem CID 39836218) has the molecular formula C19H13N3O4S3 and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide.
| Compound Name | N-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 39836218 |
| Molecular Formula | C19H13N3O4S3 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | N-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)NN1C(=O)/C(=C/c2ccc(O)cc2)SC1=S |
| InChI | InChI=1S/C19H13N3O4S3/c23-12-7-5-11(6-8-12)9-15-17(25)22(19(27)29-15)20-16(24)10-21-13-3-1-2-4-14(13)28-18(21)26/h1-9,23H,10H2,(H,20,24)/b15-9- |
| InChIKey | AGOIAADMKGLTQQ-DHDCSXOGSA-N |
| XLogP | 2.70 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|