C28H21ClN4O6S3 — CID 43842507
N-[(5Z)-5-[[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide (PubChem CID 43842507) has the molecular formula C28H21ClN4O6S3 and a molecular weight of 641.15 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide.
| Compound Name | N-[(5Z)-5-[[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 43842507 |
| Molecular Formula | C28H21ClN4O6S3 |
| Molecular Weight | 641.15 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | N-[(5Z)-5-[[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(NC(=O)Cn3c(=O)sc4ccccc43)C2=O)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H21ClN4O6S3/c1-38-21-12-16(6-11-20(21)39-15-25(35)30-18-9-7-17(29)8-10-18)13-23-26(36)33(28(40)42-23)31-24(34)14-32-19-4-2-3-5-22(19)41-27(32)37/h2-13H,14-15H2,1H3,(H,30,35)(H,31,34)/b23-13- |
| InChIKey | SSGPCDSELKPCCS-QRVIBDJDSA-N |
| XLogP | 4.68 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.15 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|